Products 109705-82-0
CAS 109705-82-0 is the registry number for rac-(3R,6S)-2-Oxatricyclo(6.4.0.0,3,6)dodeca-1(12),8,10-trien-7-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2aS,8aR)-1,2,2a,8a-tetrahydrocyclobuta[b]chromen-8-one (CAS 109705-82-0) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: (2aS,8aR)-1,2,2a,8a-tetrahydrocyclobuta[b]chromen-8-one. InChIKey: ZEDPHJBNAJTYKH-SCZZXKLOSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (2aS,8aR)-1,2,2a,8a-tetrahydrocyclobuta[b]chromen-8-one |
| InChIKey | ZEDPHJBNAJTYKH-SCZZXKLOSA-N |
| SMILES | C1C[C@H]2[C@@H]1C(=O)C3=CC=CC=C3O2 |
Computed by PubChem (NCBI)