Products 1097120-47-2
CAS 1097120-47-2 is the registry number for HadAB-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazol-4-yl]-N-methylsulfonylpropanamide (CAS 1097120-47-2) is a chemical compound with the molecular formula C19H17BrClN3O3S and a molecular weight of 482.8 g/mol. IUPAC name: 3-[1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazol-4-yl]-N-methylsulfonylpropanamide. InChIKey: HJRIVXBUFBERIX-UHFFFAOYSA-N.
| Molecular formula | C19H17BrClN3O3S |
|---|---|
| Molecular weight | 482.8 g/mol |
| IUPAC name | 3-[1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazol-4-yl]-N-methylsulfonylpropanamide |
| InChIKey | HJRIVXBUFBERIX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC(=O)CCC1=CN(N=C1C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)
Synonyms:
HadAB-IN-1, orb1744389