CAS 109715-47-1 is the registry number for (R)-3-((tert-Butyldimethylsilyl)oxy)butan-1-ol, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(3R)-3-[tert-butyl(dimethyl)silyl]oxybutan-1-ol (CAS 109715-47-1) is a chemical compound with the molecular formula C10H24O2Si and a molecular weight of 204.38 g/mol. IUPAC name: (3R)-3-[tert-butyl(dimethyl)silyl]oxybutan-1-ol. InChIKey: PIWCWAVOQLFTBN-SECBINFHSA-N.
| Molecular formula | C10H24O2Si |
|---|---|
| Molecular weight | 204.38 g/mol |
| IUPAC name | (3R)-3-[tert-butyl(dimethyl)silyl]oxybutan-1-ol |
| InChIKey | PIWCWAVOQLFTBN-SECBINFHSA-N |
| SMILES | C[C@H](CCO)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)