CAS 109719-84-8 is the registry number for 1,2,3,4,6,7,8-Heptachloro-dibenzofuran-13C12. Offered by: TRC. Available pack sizes: 2,5mg.
1,2,3,4,6,7,8-heptachlorodibenzofuran (CAS 109719-84-8) is a chemical compound with the molecular formula C12HCl7O and a molecular weight of 421.2 g/mol. IUPAC name: 1,2,3,4,6,7,8-heptachlorodibenzofuran. InChIKey: WDMKCPIVJOGHBF-WCGVKTIYSA-N.
| Molecular formula | C12HCl7O |
|---|---|
| Molecular weight | 421.2 g/mol |
| IUPAC name | 1,2,3,4,6,7,8-heptachlorodibenzofuran |
| InChIKey | WDMKCPIVJOGHBF-WCGVKTIYSA-N |
| SMILES | [13CH]1=[13C]2[13C]3=[13C]([13C](=[13C]([13C](=[13C]3Cl)Cl)Cl)Cl)O[13C]2=[13C]([13C](=[13C]1Cl)Cl)Cl |
Computed by PubChem (NCBI)