CAS 1097192-97-6 appears in our catalog under these names: 2,4,6-Tribromophenol-1,2,3,4,5,6-13C6, >95% (HPLC), 2,4,6-Tribromophenol-1,2,3,4,5,6-13C6. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 25mg, 50mg, 100mg.
2,4,6-tribromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 1097192-97-6) is a chemical compound with the molecular formula C6H3Br3O and a molecular weight of 336.76 g/mol. IUPAC name: 2,4,6-tribromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: BSWWXRFVMJHFBN-IDEBNGHGSA-N.
| Molecular formula | C6H3Br3O |
|---|---|
| Molecular weight | 336.76 g/mol |
| IUPAC name | 2,4,6-tribromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | BSWWXRFVMJHFBN-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13C]([13CH]=[13C]([13C](=[13C]1Br)O)Br)Br |
Computed by PubChem (NCBI)