Products 1097262-30-0
CAS 1097262-30-0 is the registry number for 2-((1-(4-Chlorophenyl)ethyl)amino)-N-isopropylpropanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[1-(4-chlorophenyl)ethylamino]-N-propan-2-ylpropanamide (CAS 1097262-30-0) is a chemical compound with the molecular formula C14H21ClN2O and a molecular weight of 268.78 g/mol. IUPAC name: 2-[1-(4-chlorophenyl)ethylamino]-N-propan-2-ylpropanamide. InChIKey: XAONJZAKHYIUSQ-UHFFFAOYSA-N.
| Molecular formula | C14H21ClN2O |
|---|---|
| Molecular weight | 268.78 g/mol |
| IUPAC name | 2-[1-(4-chlorophenyl)ethylamino]-N-propan-2-ylpropanamide |
| InChIKey | XAONJZAKHYIUSQ-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C(C)NC(C)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)