Products 109732-56-1

CAS 109732-56-1 is the registry number for N,N-Dimethyl-N-2-phenoxyethyl-N-2’-thenylammonium Iodide. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.

Structural formula: {0} (CAS {1})

Dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium iodide (CAS 109732-56-1) is a chemical compound with the molecular formula C15H20INOS and a molecular weight of 389.3 g/mol. IUPAC name: dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium iodide. InChIKey: MEYDOHSRJJCPTC-UHFFFAOYSA-M.

Identity
Molecular formulaC15H20INOS
Molecular weight389.3 g/mol
IUPAC namedimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium iodide
InChIKeyMEYDOHSRJJCPTC-UHFFFAOYSA-M
SMILESC[N+](C)(CCOC1=CC=CC=C1)CC2=CC=CS2.[I-]

Computed by PubChem (NCBI)