CAS 109732-56-1 is the registry number for N,N-Dimethyl-N-2-phenoxyethyl-N-2’-thenylammonium Iodide. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
Dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium iodide (CAS 109732-56-1) is a chemical compound with the molecular formula C15H20INOS and a molecular weight of 389.3 g/mol. IUPAC name: dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium iodide. InChIKey: MEYDOHSRJJCPTC-UHFFFAOYSA-M.
| Molecular formula | C15H20INOS |
|---|---|
| Molecular weight | 389.3 g/mol |
| IUPAC name | dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium iodide |
| InChIKey | MEYDOHSRJJCPTC-UHFFFAOYSA-M |
| SMILES | C[N+](C)(CCOC1=CC=CC=C1)CC2=CC=CS2.[I-] |
Computed by PubChem (NCBI)