Products 1097778-74-9
CAS 1097778-74-9 is the registry number for 6-(Trifluoromethyl)pyridin-3-yltrifluoromethanesulfonate, 95%. Offered by: Fluorochem. Available pack sizes: 5g.
[6-(trifluoromethyl)-3-pyridinyl] trifluoromethanesulfonate (CAS 1097778-74-9) is a chemical compound with the molecular formula C7H3F6NO3S and a molecular weight of 295.16 g/mol. IUPAC name: [6-(trifluoromethyl)-3-pyridinyl] trifluoromethanesulfonate. InChIKey: YXTDRVFQMVNSGJ-UHFFFAOYSA-N.
| Molecular formula | C7H3F6NO3S |
|---|---|
| Molecular weight | 295.16 g/mol |
| IUPAC name | [6-(trifluoromethyl)-3-pyridinyl] trifluoromethanesulfonate |
| InChIKey | YXTDRVFQMVNSGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1OS(=O)(=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)