Products 1097788-36-7
CAS 1097788-36-7 is the registry number for 1-((4-Chloro-3-nitrophenyl)methyl)-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[(4-chloro-3-nitrophenyl)methyl]pyridin-2-one (CAS 1097788-36-7) is a chemical compound with the molecular formula C12H9ClN2O3 and a molecular weight of 264.66 g/mol. IUPAC name: 1-[(4-chloro-3-nitrophenyl)methyl]pyridin-2-one. InChIKey: SSAFFAHNLBIJNR-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O3 |
|---|---|
| Molecular weight | 264.66 g/mol |
| IUPAC name | 1-[(4-chloro-3-nitrophenyl)methyl]pyridin-2-one |
| InChIKey | SSAFFAHNLBIJNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1)CC2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)