Products 1097874-78-6

CAS 1097874-78-6 appears in our catalog under these names: 1–Ethynyl–2,4,5–trifluorobenzene, 1-Ethynyl-2,4,5-trifluorobenzene, 1-Ethynyl-2,4,5-trifluorobenzene 95%, 1-Ethynyl-2,4,5-trifluorobenzene, 95%, 95%, 1-Ethynyl-2,4,5-trifluorobenzene, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 2,5g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-ethynyl-2,4,5-trifluorobenzene (CAS 1097874-78-6) is a chemical compound with the molecular formula C8H3F3 and a molecular weight of 156.10 g/mol. IUPAC name: 1-ethynyl-2,4,5-trifluorobenzene. InChIKey: GFSHMVIJBUJEKV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3F3
Molecular weight156.10 g/mol
IUPAC name1-ethynyl-2,4,5-trifluorobenzene
InChIKeyGFSHMVIJBUJEKV-UHFFFAOYSA-N
SMILESC#CC1=CC(=C(C=C1F)F)F

Computed by PubChem (NCBI)