CAS 1097922-04-7 is the registry number for 1-(6-Amino-7-chloro-3,4-dihydroisoquinolin-2(1h)-yl)-2,2,2-trifluoroethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-(6-amino-7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone (CAS 1097922-04-7) is a chemical compound with the molecular formula C11H10ClF3N2O and a molecular weight of 278.66 g/mol. IUPAC name: 1-(6-amino-7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone. InChIKey: AESUHWZTMPXZNX-UHFFFAOYSA-N.
| Molecular formula | C11H10ClF3N2O |
|---|---|
| Molecular weight | 278.66 g/mol |
| IUPAC name | 1-(6-amino-7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone |
| InChIKey | AESUHWZTMPXZNX-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC(=C(C=C21)N)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)