CAS 109793-93-3 is the registry number for 2,2-Dibromo-3-nitropropionamide. Offered by: TRC. Available pack sizes: 250mg.
2,2-dibromo-3-nitropropanamide (CAS 109793-93-3) is a chemical compound with the molecular formula C3H4Br2N2O3 and a molecular weight of 275.88 g/mol. IUPAC name: 2,2-dibromo-3-nitropropanamide. InChIKey: CKEKCWHEPUAYPC-UHFFFAOYSA-N.
| Molecular formula | C3H4Br2N2O3 |
|---|---|
| Molecular weight | 275.88 g/mol |
| IUPAC name | 2,2-dibromo-3-nitropropanamide |
| InChIKey | CKEKCWHEPUAYPC-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)N)(Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)