CAS 1098-68-6 is the registry number for Methylcobalamin Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (CAS 1098-68-6) is a chemical compound with the molecular formula C14H19N2O7P and a molecular weight of 358.28 g/mol. IUPAC name: [(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate. InChIKey: JIABVZWSYKDHDJ-SYQHCUMBSA-N.
| Molecular formula | C14H19N2O7P |
|---|---|
| Molecular weight | 358.28 g/mol |
| IUPAC name | [(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| InChIKey | JIABVZWSYKDHDJ-SYQHCUMBSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C=N2)[C@@H]3[C@@H]([C@@H]([C@H](O3)CO)OP(=O)(O)O)O |
Computed by PubChem (NCBI)