CAS 109812-56-8 appears in our catalog under these names: alpha,alpha-Diphenyl-2-pyridinemethanol Hydrochloride, a,a-Diphenyl-2-pyridinemethanol hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
Diphenyl(pyridin-2-yl)methanol;hydrochloride (CAS 109812-56-8) is a chemical compound with the molecular formula C18H16ClNO and a molecular weight of 297.8 g/mol. IUPAC name: diphenyl(pyridin-2-yl)methanol;hydrochloride. InChIKey: ROMDRFVOHSEQMP-UHFFFAOYSA-N.
| Molecular formula | C18H16ClNO |
|---|---|
| Molecular weight | 297.8 g/mol |
| IUPAC name | diphenyl(pyridin-2-yl)methanol;hydrochloride |
| InChIKey | ROMDRFVOHSEQMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=N3)O.Cl |
Computed by PubChem (NCBI)