CAS 109826-68-8 appears in our catalog under these names: Teprenone Impurity 22, 6,10,14,18-Tetramethyl-5,9,13,17-nonadecatertaen-2-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(5E,9E,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-ol (CAS 109826-68-8) is a chemical compound with the molecular formula C23H40O and a molecular weight of 332.6 g/mol. IUPAC name: (5E,9E,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-ol. InChIKey: PQOZEIOCRSIRHY-NJFMWZAGSA-N.
| Molecular formula | C23H40O |
|---|---|
| Molecular weight | 332.6 g/mol |
| IUPAC name | (5E,9E,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-ol |
| InChIKey | PQOZEIOCRSIRHY-NJFMWZAGSA-N |
| SMILES | CC(CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)O |
Computed by PubChem (NCBI)