CAS 109833-18-3 is the registry number for 1H-Imidazolium, 3-(2-ethoxy-2-oxoethyl)-1-methyl-, bromide (1:1), 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g.
Ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide (CAS 109833-18-3) is a chemical compound with the molecular formula C8H13BrN2O2 and a molecular weight of 249.10 g/mol. IUPAC name: ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide. InChIKey: OTUYNJCOAWYCNC-UHFFFAOYSA-M.
| Molecular formula | C8H13BrN2O2 |
|---|---|
| Molecular weight | 249.10 g/mol |
| IUPAC name | ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide |
| InChIKey | OTUYNJCOAWYCNC-UHFFFAOYSA-M |
| SMILES | CCOC(=O)CN1C=C[N+](=C1)C.[Br-] |
Computed by PubChem (NCBI)