Products 1098343-13-5
CAS 1098343-13-5 is the registry number for N-(4-Bromo-2-chlorophenyl)-3-chloropropanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
N-(4-bromo-2-chlorophenyl)-3-chloropropanamide (CAS 1098343-13-5) is a chemical compound with the molecular formula C9H8BrCl2NO and a molecular weight of 296.97 g/mol. IUPAC name: N-(4-bromo-2-chlorophenyl)-3-chloropropanamide. InChIKey: VCLRXTRJGREVOH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrCl2NO |
|---|---|
| Molecular weight | 296.97 g/mol |
| IUPAC name | N-(4-bromo-2-chlorophenyl)-3-chloropropanamide |
| InChIKey | VCLRXTRJGREVOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)NC(=O)CCCl |
Computed by PubChem (NCBI)