CAS 1098350-83-4 is the registry number for 2,3,4,5-Tetrafluorobenzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,4,5-tetrafluorobenzohydrazide (CAS 1098350-83-4) is a chemical compound with the molecular formula C7H4F4N2O and a molecular weight of 208.11 g/mol. IUPAC name: 2,3,4,5-tetrafluorobenzohydrazide. InChIKey: KNTXMOXRWWEQRQ-UHFFFAOYSA-N.
| Molecular formula | C7H4F4N2O |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2,3,4,5-tetrafluorobenzohydrazide |
| InChIKey | KNTXMOXRWWEQRQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)C(=O)NN |
Computed by PubChem (NCBI)