Products 109836-82-0

CAS 109836-82-0 is the registry number for D-threo-PDMP, 99.50%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 100 mg, 10 mg, 10mM/1mL, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

N-[(1R,2R)-1-hydroxy-3-morpholin-4-yl-1-phenylpropan-2-yl]decanamide;hydrochloride (CAS 109836-82-0) is a chemical compound with the molecular formula C23H39ClN2O3 and a molecular weight of 427.0 g/mol. IUPAC name: N-[(1R,2R)-1-hydroxy-3-morpholin-4-yl-1-phenylpropan-2-yl]decanamide;hydrochloride. InChIKey: HVJHJOYQTSEKPK-BLDCTAJRSA-N.

Identity
Molecular formulaC23H39ClN2O3
Molecular weight427.0 g/mol
IUPAC nameN-[(1R,2R)-1-hydroxy-3-morpholin-4-yl-1-phenylpropan-2-yl]decanamide;hydrochloride
InChIKeyHVJHJOYQTSEKPK-BLDCTAJRSA-N
SMILESCCCCCCCCCC(=O)N[C@H](CN1CCOCC1)[C@@H](C2=CC=CC=C2)O.Cl

Computed by PubChem (NCBI)