CAS 1098360-68-9 appears in our catalog under these names: N-(4-Bromo-2-chlorophenyl)-5-chloro-2-hydroxybenzamide, 95%, N-(4-bromo-2-chlorophenyl)-5-chloro-2-hydroxybenzamide/ 95%, N-(4-Bromo-2-chlorophenyl)-5-chloro-2-hydroxybenzamide. Offered by: AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 5g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
N-(4-bromo-2-chlorophenyl)-5-chloro-2-hydroxybenzamide (CAS 1098360-68-9) is a chemical compound with the molecular formula C13H8BrCl2NO2 and a molecular weight of 361.0 g/mol. IUPAC name: N-(4-bromo-2-chlorophenyl)-5-chloro-2-hydroxybenzamide. InChIKey: UOPADSHREFFSQC-UHFFFAOYSA-N.
| Molecular formula | C13H8BrCl2NO2 |
|---|---|
| Molecular weight | 361.0 g/mol |
| IUPAC name | N-(4-bromo-2-chlorophenyl)-5-chloro-2-hydroxybenzamide |
| InChIKey | UOPADSHREFFSQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)NC2=C(C=C(C=C2)Br)Cl)O |
Computed by PubChem (NCBI)