CAS 1098369-17-5 appears in our catalog under these names: 1-(5-Chloro-2,3-dihydro-1-benzofuran-2-carbonyl)piperidine-3-carboxylic acid, 95%, 1-(5-Chloro-2,3-dihydro-1-benzofuran-2-carbonyl)piperidine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl)piperidine-3-carboxylic acid (CAS 1098369-17-5) is a chemical compound with the molecular formula C15H16ClNO4 and a molecular weight of 309.74 g/mol. IUPAC name: 1-(5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl)piperidine-3-carboxylic acid. InChIKey: SMCHLATVDOUCBF-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO4 |
|---|---|
| Molecular weight | 309.74 g/mol |
| IUPAC name | 1-(5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl)piperidine-3-carboxylic acid |
| InChIKey | SMCHLATVDOUCBF-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C2CC3=C(O2)C=CC(=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)