Products 1098372-23-6
CAS 1098372-23-6 is the registry number for 2-(((8-Chloro-2,3-dihydrobenzo[b][1,4]dioxin-6-yl)methyl)thio)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]propanoic acid (CAS 1098372-23-6) is a chemical compound with the molecular formula C12H13ClO4S and a molecular weight of 288.75 g/mol. IUPAC name: 2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]propanoic acid. InChIKey: DDKYFGUWSGUXCH-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO4S |
|---|---|
| Molecular weight | 288.75 g/mol |
| IUPAC name | 2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]propanoic acid |
| InChIKey | DDKYFGUWSGUXCH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)SCC1=CC2=C(C(=C1)Cl)OCCO2 |
Computed by PubChem (NCBI)