Products 1099107-68-2

CAS 1099107-68-2 is the registry number for 3-{(4-(1H-1,2,3,4-Tetrazol-5-yl)phenyl)formamido}propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-[[4-(2H-tetrazol-5-yl)benzoyl]amino]propanoic acid (CAS 1099107-68-2) is a chemical compound with the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. IUPAC name: 3-[[4-(2H-tetrazol-5-yl)benzoyl]amino]propanoic acid. InChIKey: XZTUFJFHZZRGQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N5O3
Molecular weight261.24 g/mol
IUPAC name3-[[4-(2H-tetrazol-5-yl)benzoyl]amino]propanoic acid
InChIKeyXZTUFJFHZZRGQZ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NNN=N2)C(=O)NCCC(=O)O

Computed by PubChem (NCBI)