CAS 1099110-57-2 appears in our catalog under these names: 5-Bromo-4-sulfamoylthiophene-2-carboxylic acid, 5-Bromo-4-sulfamoylthiophene-2-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 1g, 2g, 5g, 10g, 250mg, 100mg.
5-bromo-4-sulfamoylthiophene-2-carboxylic acid (CAS 1099110-57-2) is a chemical compound with the molecular formula C5H4BrNO4S2 and a molecular weight of 286.1 g/mol. IUPAC name: 5-bromo-4-sulfamoylthiophene-2-carboxylic acid. InChIKey: NQEBGFJRWNZOHK-UHFFFAOYSA-N.
| Molecular formula | C5H4BrNO4S2 |
|---|---|
| Molecular weight | 286.1 g/mol |
| IUPAC name | 5-bromo-4-sulfamoylthiophene-2-carboxylic acid |
| InChIKey | NQEBGFJRWNZOHK-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1S(=O)(=O)N)Br)C(=O)O |
Computed by PubChem (NCBI)