CAS 1099597-43-9 is the registry number for 1-Chloro-2-fluoro-3,4-bis-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-chloro-2-fluoro-3,4-bis(trifluoromethyl)benzene (CAS 1099597-43-9) is a chemical compound with the molecular formula C8H2ClF7 and a molecular weight of 266.54 g/mol. IUPAC name: 1-chloro-2-fluoro-3,4-bis(trifluoromethyl)benzene. InChIKey: RSGXVUJZLLOLMX-UHFFFAOYSA-N.
| Molecular formula | C8H2ClF7 |
|---|---|
| Molecular weight | 266.54 g/mol |
| IUPAC name | 1-chloro-2-fluoro-3,4-bis(trifluoromethyl)benzene |
| InChIKey | RSGXVUJZLLOLMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)C(F)(F)F)F)Cl |
Computed by PubChem (NCBI)