CAS 1099597-55-3 is the registry number for 1,3-Dichloro-2-(3,3,3-trifluoropropyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,3-dichloro-2-(3,3,3-trifluoropropyl)benzene (CAS 1099597-55-3) is a chemical compound with the molecular formula C9H7Cl2F3 and a molecular weight of 243.05 g/mol. IUPAC name: 1,3-dichloro-2-(3,3,3-trifluoropropyl)benzene. InChIKey: XITDEMGBNBNGIE-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2F3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 1,3-dichloro-2-(3,3,3-trifluoropropyl)benzene |
| InChIKey | XITDEMGBNBNGIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CCC(F)(F)F)Cl |
Computed by PubChem (NCBI)