CAS 1099597-52-0 is the registry number for 1,2-Dichloro-4-(3,3,3-trifluoropropyl)benzene. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
1,2-dichloro-4-(3,3,3-trifluoropropyl)benzene (CAS 1099597-52-0) is a chemical compound with the molecular formula C9H7Cl2F3 and a molecular weight of 243.05 g/mol. IUPAC name: 1,2-dichloro-4-(3,3,3-trifluoropropyl)benzene. InChIKey: VXQTUEFTNTYYHW-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2F3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 1,2-dichloro-4-(3,3,3-trifluoropropyl)benzene |
| InChIKey | VXQTUEFTNTYYHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCC(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)