Products 1099597-68-8
CAS 1099597-68-8 is the registry number for 1-Fluoro-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-fluoro-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene (CAS 1099597-68-8) is a chemical compound with the molecular formula C9H5F7 and a molecular weight of 246.12 g/mol. IUPAC name: 1-fluoro-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene. InChIKey: PACQMIHUZCLGNX-UHFFFAOYSA-N.
| Molecular formula | C9H5F7 |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 1-fluoro-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene |
| InChIKey | PACQMIHUZCLGNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CC(F)(F)F)F |
Computed by PubChem (NCBI)