CAS 378-34-7 is the registry number for Heptafluoroisopropylbenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene (CAS 378-34-7) is a chemical compound with the molecular formula C9H5F7 and a molecular weight of 246.12 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene. InChIKey: CHPJUEBSVFTIRX-UHFFFAOYSA-N.
| Molecular formula | C9H5F7 |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene |
| InChIKey | CHPJUEBSVFTIRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)