CAS 1099640-82-0 is the registry number for N-(4-Bromo-2-fluorobenzyl)cyclopentanamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(4-bromo-2-fluorophenyl)methyl]cyclopentanamine (CAS 1099640-82-0) is a chemical compound with the molecular formula C12H15BrFN and a molecular weight of 272.16 g/mol. IUPAC name: N-[(4-bromo-2-fluorophenyl)methyl]cyclopentanamine. InChIKey: DUAPGRXWOJXAKP-UHFFFAOYSA-N.
| Molecular formula | C12H15BrFN |
|---|---|
| Molecular weight | 272.16 g/mol |
| IUPAC name | N-[(4-bromo-2-fluorophenyl)methyl]cyclopentanamine |
| InChIKey | DUAPGRXWOJXAKP-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NCC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)