CAS 1099660-34-0 is the registry number for 3-(5-(4-Butylphenyl)thiophen-2-yl)prop-2-enoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(E)-3-[5-(4-butylphenyl)thiophen-2-yl]prop-2-enoic acid (CAS 1099660-34-0) is a chemical compound with the molecular formula C17H18O2S and a molecular weight of 286.4 g/mol. IUPAC name: (E)-3-[5-(4-butylphenyl)thiophen-2-yl]prop-2-enoic acid. InChIKey: MHVHXABZECCFPX-ZRDIBKRKSA-N.
| Molecular formula | C17H18O2S |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (E)-3-[5-(4-butylphenyl)thiophen-2-yl]prop-2-enoic acid |
| InChIKey | MHVHXABZECCFPX-ZRDIBKRKSA-N |
| SMILES | CCCCC1=CC=C(C=C1)C2=CC=C(S2)/C=C/C(=O)O |
Computed by PubChem (NCBI)