Products 1099660-72-6

CAS 1099660-72-6 appears in our catalog under these names: 2-Chloro-4-iodobenzene-1-sulfonyl chloride, 95%, 2-Chloro-4-iodobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

2-chloro-4-iodobenzenesulfonyl chloride (CAS 1099660-72-6) is a chemical compound with the molecular formula C6H3Cl2IO2S and a molecular weight of 336.96 g/mol. IUPAC name: 2-chloro-4-iodobenzenesulfonyl chloride. InChIKey: ICVMRDPGPFENNX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl2IO2S
Molecular weight336.96 g/mol
IUPAC name2-chloro-4-iodobenzenesulfonyl chloride
InChIKeyICVMRDPGPFENNX-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1I)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)