Products 1099671-03-0
CAS 1099671-03-0 is the registry number for 2-(3-Methylbutan-2-yl)-2,3-dihydro-1H-isoindol-4-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(3-methylbutan-2-yl)-1,3-dihydroisoindol-4-amine (CAS 1099671-03-0) is a chemical compound with the molecular formula C13H20N2 and a molecular weight of 204.31 g/mol. IUPAC name: 2-(3-methylbutan-2-yl)-1,3-dihydroisoindol-4-amine. InChIKey: CFLRYVYXBQEJDR-UHFFFAOYSA-N.
| Molecular formula | C13H20N2 |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 2-(3-methylbutan-2-yl)-1,3-dihydroisoindol-4-amine |
| InChIKey | CFLRYVYXBQEJDR-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)N1CC2=C(C1)C(=CC=C2)N |
Computed by PubChem (NCBI)