CAS 1100-22-7 appears in our catalog under these names: 5-Dimethylaminonaphthalene-1-sulfonyl-l-leucine, 95%, Dansyl-L-leucine, 98%, Dansyl–L–leucine, Dansyl-L-leucine, >98.0%(T)(HPLC), Dansyl-L-leucine, 99.54%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, MedChemExpress. Available pack sizes: 250mg, 1g, 10mg, 100mg, 25 mg, 5mg.
(2S)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-4-methylpentanoic acid (CAS 1100-22-7) is a chemical compound with the molecular formula C18H24N2O4S and a molecular weight of 364.5 g/mol. IUPAC name: (2S)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-4-methylpentanoic acid. InChIKey: XBMQRPDOXIPUFG-HNNXBMFYSA-N.
| Molecular formula | C18H24N2O4S |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | (2S)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-4-methylpentanoic acid |
| InChIKey | XBMQRPDOXIPUFG-HNNXBMFYSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NS(=O)(=O)C1=CC=CC2=C1C=CC=C2N(C)C |
Computed by PubChem (NCBI)