CAS 1100598-32-0 appears in our catalog under these names: Tepotinib, Tepotinib/ 98.37% (existing batch purity), EMD–1214063, Tepotinib, 98%, Tepotinib 98%. Offered by: Chemat Brand, TargetMol, GLPBio, Thermo Scientific (Acros), Ambeed. Available pack sizes: on request, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
3-[1-[[3-[5-[(1-methylpiperidin-4-yl)methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile (CAS 1100598-32-0) is a chemical compound with the molecular formula C29H28N6O2 and a molecular weight of 492.6 g/mol. IUPAC name: 3-[1-[[3-[5-[(1-methylpiperidin-4-yl)methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile. InChIKey: AHYMHWXQRWRBKT-UHFFFAOYSA-N.
| Molecular formula | C29H28N6O2 |
|---|---|
| Molecular weight | 492.6 g/mol |
| IUPAC name | 3-[1-[[3-[5-[(1-methylpiperidin-4-yl)methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
| InChIKey | AHYMHWXQRWRBKT-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)COC2=CN=C(N=C2)C3=CC=CC(=C3)CN4C(=O)C=CC(=N4)C5=CC=CC(=C5)C#N |
Computed by PubChem (NCBI)