CAS 1100750-65-9 is the registry number for 4-Fluorobenzamide-D4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 5mg, 5 mg, 10 mg, 2.5 mg.
2,3,5,6-tetradeuterio-4-fluorobenzamide (CAS 1100750-65-9) is a chemical compound with the molecular formula C7H6FNO and a molecular weight of 143.15 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-fluorobenzamide. InChIKey: VNDHYTGVCGVETQ-RHQRLBAQSA-N.
| Molecular formula | C7H6FNO |
|---|---|
| Molecular weight | 143.15 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-fluorobenzamide |
| InChIKey | VNDHYTGVCGVETQ-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)N)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)