CAS 110076-44-3 is the registry number for o-Chloramine T. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 250mg, 500mg, 25g.
Sodium chloro-(2-methylphenyl)sulfonylazanide (CAS 110076-44-3) is a chemical compound with the molecular formula C7H7ClNNaO2S and a molecular weight of 227.64 g/mol. IUPAC name: sodium chloro-(2-methylphenyl)sulfonylazanide. InChIKey: BMVGZYMMLBPFDA-UHFFFAOYSA-N.
| Molecular formula | C7H7ClNNaO2S |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | sodium chloro-(2-methylphenyl)sulfonylazanide |
| InChIKey | BMVGZYMMLBPFDA-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1S(=O)(=O)[N-]Cl.[Na+] |
Computed by PubChem (NCBI)