CAS 1100832-66-3 is the registry number for 3-chloro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-chloro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline (CAS 1100832-66-3) is a chemical compound with the molecular formula C9H6ClF6NO and a molecular weight of 293.59 g/mol. IUPAC name: 3-chloro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline. InChIKey: NVZSCSQYYUTATB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF6NO |
|---|---|
| Molecular weight | 293.59 g/mol |
| IUPAC name | 3-chloro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
| InChIKey | NVZSCSQYYUTATB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)OC(C(C(F)(F)F)F)(F)F |
Computed by PubChem (NCBI)