CAS 110170-37-1 appears in our catalog under these names: 4–Galloylquinic acid, 4-Galloylquinic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
Trans-(3R,5R)-1,3,5-trihydroxy-4-(3,4,5-trihydroxybenzoyl)oxycyclohexane-1-carboxylic acid (CAS 110170-37-1) is a chemical compound with the molecular formula C14H16O10 and a molecular weight of 344.27 g/mol. IUPAC name: trans-(3R,5R)-1,3,5-trihydroxy-4-(3,4,5-trihydroxybenzoyl)oxycyclohexane-1-carboxylic acid. InChIKey: OGYBSNRRBNHPNK-LPSXRXAPSA-N.
| Molecular formula | C14H16O10 |
|---|---|
| Molecular weight | 344.27 g/mol |
| IUPAC name | trans-(3R,5R)-1,3,5-trihydroxy-4-(3,4,5-trihydroxybenzoyl)oxycyclohexane-1-carboxylic acid |
| InChIKey | OGYBSNRRBNHPNK-LPSXRXAPSA-N |
| SMILES | C1[C@H](C([C@@H](CC1(C(=O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O |
Computed by PubChem (NCBI)