Products 1101843-44-0
CAS 1101843-44-0 is the registry number for 1-(2-Phenylacetyl)piperidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2-phenylacetyl)piperidine-2-carboxylic acid (CAS 1101843-44-0) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: 1-(2-phenylacetyl)piperidine-2-carboxylic acid. InChIKey: ZQPYJXXYTOWXCT-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 1-(2-phenylacetyl)piperidine-2-carboxylic acid |
| InChIKey | ZQPYJXXYTOWXCT-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)C(=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)