CAS 1102-92-7 appears in our catalog under these names: 4,4'-(Perfluoropropane-2,2-diyl)dibenzoyl Chloride, >98.0%(GC)(T), Benzoyl chloride, 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis-, 98.0%, 98.0%. Offered by: TCI, Chemat. Available pack sizes: 5g, 25g.
4-[2-(4-carbonochloridoylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoyl chloride (CAS 1102-92-7) is a chemical compound with the molecular formula C17H8Cl2F6O2 and a molecular weight of 429.1 g/mol. IUPAC name: 4-[2-(4-carbonochloridoylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoyl chloride. InChIKey: YMTNDQJOFCTPBI-UHFFFAOYSA-N.
| Molecular formula | C17H8Cl2F6O2 |
|---|---|
| Molecular weight | 429.1 g/mol |
| IUPAC name | 4-[2-(4-carbonochloridoylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoyl chloride |
| InChIKey | YMTNDQJOFCTPBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)C(C2=CC=C(C=C2)C(=O)Cl)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)