CAS 110230-95-0 is the registry number for Rs-029. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3-bis(2-methyl-4-nitroimidazol-1-yl)propan-2-yl acetate (CAS 110230-95-0) is a chemical compound with the molecular formula C13H16N6O6 and a molecular weight of 352.30 g/mol. IUPAC name: 1,3-bis(2-methyl-4-nitroimidazol-1-yl)propan-2-yl acetate. InChIKey: XCOGTTVSYZHWCD-UHFFFAOYSA-N.
| Molecular formula | C13H16N6O6 |
|---|---|
| Molecular weight | 352.30 g/mol |
| IUPAC name | 1,3-bis(2-methyl-4-nitroimidazol-1-yl)propan-2-yl acetate |
| InChIKey | XCOGTTVSYZHWCD-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1CC(CN2C=C(N=C2C)[N+](=O)[O-])OC(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)