CAS 110287-64-4 is the registry number for rac-ethyl (2R,3R)-2-methylpiperidine-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl (2R,3R)-2-methylpiperidine-3-carboxylate (CAS 110287-64-4) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: ethyl (2R,3R)-2-methylpiperidine-3-carboxylate. InChIKey: QRSUHEMVICBCFP-HTQZYQBOSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | ethyl (2R,3R)-2-methylpiperidine-3-carboxylate |
| InChIKey | QRSUHEMVICBCFP-HTQZYQBOSA-N |
| SMILES | CCOC(=O)[C@@H]1CCCN[C@@H]1C |
Computed by PubChem (NCBI)