Products 1103295-14-2

CAS 1103295-14-2 is the registry number for N-Cyclohexyl-n-methylalanine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[cyclohexyl(methyl)amino]propanoic acid (CAS 1103295-14-2) is a chemical compound with the molecular formula C10H19NO2 and a molecular weight of 185.26 g/mol. IUPAC name: 2-[cyclohexyl(methyl)amino]propanoic acid. InChIKey: WTDHSXGBDZBWAW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19NO2
Molecular weight185.26 g/mol
IUPAC name2-[cyclohexyl(methyl)amino]propanoic acid
InChIKeyWTDHSXGBDZBWAW-UHFFFAOYSA-N
SMILESCC(C(=O)O)N(C)C1CCCCC1

Computed by PubChem (NCBI)