CAS 1103738-29-9 appears in our catalog under these names: Dapagliflozin Impurity 20, Dapagliflozin Impurity 105, 1–Chloro–2–(4–ethoxybenzyl)–4–iodobenzene, 1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene 98%, 1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene, 98%, 98%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100g, 25g, 500g, 250mg, 1g, 5g, 10g.
1-chloro-2-[(4-ethoxyphenyl)methyl]-4-iodobenzene (CAS 1103738-29-9) is a chemical compound with the molecular formula C15H14ClIO and a molecular weight of 372.63 g/mol. IUPAC name: 1-chloro-2-[(4-ethoxyphenyl)methyl]-4-iodobenzene. InChIKey: CZFRIPGHKLGMEU-UHFFFAOYSA-N.
| Molecular formula | C15H14ClIO |
|---|---|
| Molecular weight | 372.63 g/mol |
| IUPAC name | 1-chloro-2-[(4-ethoxyphenyl)methyl]-4-iodobenzene |
| InChIKey | CZFRIPGHKLGMEU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)I)Cl |
Computed by PubChem (NCBI)