CAS 1104-49-0 appears in our catalog under these names: Nafcillin Impurity 4 Sodium Salt, Desmethyl Nafcillin Sodium Salt. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
CAS 1104-49-0 identifies a chemical compound with the molecular formula C20H20N2NaO5S and a molecular weight of 423.4 g/mol. InChIKey: RUVCZVUDVRMREH-GDUZTWOJSA-N.
| Molecular formula | C20H20N2NaO5S |
|---|---|
| Molecular weight | 423.4 g/mol |
| InChIKey | RUVCZVUDVRMREH-GDUZTWOJSA-N |
| SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)C3=C(C=CC4=CC=CC=C43)OC)C(=O)O)C.[Na] |
Computed by PubChem (NCBI)