CAS 1104000-68-1 appears in our catalog under these names: (3R,4R)-Pyrrolidine-3,4-diol hydrochloride, (3R,4R)-Pyrrolidine-3,4-diol hydrochloride, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 2g, 1g, 5g, 10g.
(3R,4R)-pyrrolidine-3,4-diol;hydrochloride (CAS 1104000-68-1) is a chemical compound with the molecular formula C4H10ClNO2 and a molecular weight of 139.58 g/mol. IUPAC name: (3R,4R)-pyrrolidine-3,4-diol;hydrochloride. InChIKey: VADWFRGDDJHKNB-VKKIDBQXSA-N.
| Molecular formula | C4H10ClNO2 |
|---|---|
| Molecular weight | 139.58 g/mol |
| IUPAC name | (3R,4R)-pyrrolidine-3,4-diol;hydrochloride |
| InChIKey | VADWFRGDDJHKNB-VKKIDBQXSA-N |
| SMILES | C1[C@H]([C@@H](CN1)O)O.Cl |
Computed by PubChem (NCBI)