CAS 110448-35-6 is the registry number for 5-Iodonaphthalene-1-sulfonylchloride. Offered by: TRC. Available pack sizes: 500mg.
5-iodonaphthalene-1-sulfonyl chloride (CAS 110448-35-6) is a chemical compound with the molecular formula C10H6ClIO2S and a molecular weight of 352.58 g/mol. IUPAC name: 5-iodonaphthalene-1-sulfonyl chloride. InChIKey: HPGIIEANQDDHGE-UHFFFAOYSA-N.
| Molecular formula | C10H6ClIO2S |
|---|---|
| Molecular weight | 352.58 g/mol |
| IUPAC name | 5-iodonaphthalene-1-sulfonyl chloride |
| InChIKey | HPGIIEANQDDHGE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2I)C(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)