CAS 1104580-85-9 is the registry number for 2-(3,3-Dimethylbutanamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(3,3-dimethylbutanoylamino)propanoic acid (CAS 1104580-85-9) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: 2-(3,3-dimethylbutanoylamino)propanoic acid. InChIKey: VTWGNAOOGHTLEK-UHFFFAOYSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2-(3,3-dimethylbutanoylamino)propanoic acid |
| InChIKey | VTWGNAOOGHTLEK-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)CC(C)(C)C |
Computed by PubChem (NCBI)