CAS 110506-85-9 appears in our catalog under these names: 7-(Benzyloxy)-5-hydroxy-2-phenyl-4H-chromen-4-one, 97%, 7-(Benzyloxy)-5-hydroxy-2-phenyl-4H-chromen-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g.
5-hydroxy-2-phenyl-7-phenylmethoxychromen-4-one (CAS 110506-85-9) is a chemical compound with the molecular formula C22H16O4 and a molecular weight of 344.4 g/mol. IUPAC name: 5-hydroxy-2-phenyl-7-phenylmethoxychromen-4-one. InChIKey: HIYMWHBMOOSAEF-UHFFFAOYSA-N.
| Molecular formula | C22H16O4 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 5-hydroxy-2-phenyl-7-phenylmethoxychromen-4-one |
| InChIKey | HIYMWHBMOOSAEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C3C(=C2)OC(=CC3=O)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)